![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 3 Working Days/ | 2024-12-11 15:03 | - | |
| 9 Windows/ | 2024-10-21 21:30 | - | |
| 10 dias de un hombre curioso/ | 2024-11-08 18:52 | - | |
| 12 To Midnight/ | 2024-12-05 19:47 | - | |
| 13th Summer/ | 2024-09-22 16:14 | - | |
| 52 Hertz No Kujiratachi/ | 2024-12-05 19:48 | - | |
| 1992/ | 2024-11-18 00:47 | - | |
| 1995/ | 2024-11-14 03:36 | - | |
| A 90s Christmas/ | 2024-11-30 21:34 | - | |
| A Bluegrass Christmas/ | 2024-11-29 23:01 | - | |
| A Carol For Two/ | 2024-11-07 00:27 | - | |
| A Christmas Less Traveled/ | 2024-11-30 21:34 | - | |
| A Christmas Miracle/ | 2024-11-20 00:35 | - | |
| A Dance In The Snow/ | 2024-12-06 22:24 | - | |
| A Different Man/ | 2024-11-05 19:00 | - | |
| A Family Thing/ | 2024-09-24 17:44 | - | |
| A Good Enough Day/ | 2024-12-03 00:43 | - | |
| A Harvest Homecoming/ | 2024-12-05 19:48 | - | |
| A Holiday For Harmony/ | 2024-11-12 21:30 | - | |
| AI Evolution/ | 2024-12-06 01:36 | - | |
| AMFAD All My Friends Are Dead/ | 2024-11-20 00:36 | - | |
| A Missed Connection/ | 2024-11-19 04:10 | - | |
| A Mistake/ | 2024-11-05 18:53 | - | |
| A Nonsense Christmas With Sabrina Carpenter/ | 2024-12-08 04:55 | - | |
| A Novel Noel/ | 2024-11-27 16:38 | - | |
| A Reason For The Season/ | 2024-11-19 04:10 | - | |
| A Strange House/ | 2024-11-18 00:48 | - | |
| A Toast To Love/ | 2024-12-03 00:44 | - | |
| Abrazo de Madre/ | 2024-10-24 04:05 | - | |
| Abrazo de madre/ | 2024-10-31 16:48 | - | |
| Absolution/ | 2024-11-20 00:35 | - | |
| Adam Ray Is Dr Phil Unleashed/ | 2024-11-23 03:43 | - | |
| Afraid/ | 2024-09-22 16:20 | - | |
| Aftermath/ | 2024-11-03 02:56 | - | |
| Aire Just Breathe/ | 2024-12-11 15:07 | - | |
| Alerta Amber/ | 2024-10-31 13:42 | - | |
| Alien Romulus/ | 2024-10-15 04:52 | - | |
| All You Need Is Blood/ | 2024-12-03 00:44 | - | |
| Allen Sunshine/ | 2024-12-05 19:48 | - | |
| Am I Racist/ | 2024-10-29 02:59 | - | |
| Amaran/ | 2024-12-06 01:36 | - | |
| Amityville Where the Echo Lives/ | 2024-11-03 02:54 | - | |
| An Evening With Dua Lipa/ | 2024-12-10 02:32 | - | |
| And Mrs/ | 2024-12-03 19:42 | - | |
| Andhagan/ | 2024-11-29 23:01 | - | |
| Anthony Jeselnik Bones And All/ | 2024-11-27 16:40 | - | |
| Apartment/ | 2024-09-29 23:50 | - | |
| Apocalipsis Z El principio del fin/ | 2024-10-31 13:42 | - | |
| Apple Music Live Camila Cabello/ | 2024-09-24 05:03 | - | |
| Appudo Ippudo Eppudo/ | 2024-12-06 01:36 | - | |
| Aprender a soltar/ | 2024-11-02 17:06 | - | |
| Aquella Navidad/ | 2024-12-04 17:18 | - | |
| Armor/ | 2024-11-22 14:07 | - | |
| Asphalt City/ | 2024-12-12 01:36 | - | |
| Assassins Guild/ | 2024-11-07 00:17 | - | |
| Atrevida La Pasion No Tiene Reglas/ | 2024-11-01 20:47 | - | |
| Average Joe/ | 2024-11-09 19:56 | - | |
| BEATLES/ | 2024-11-29 23:01 | - | |
| Bad Actor A Hollywood.Ponzi Scheme/ | 2024-12-03 19:27 | - | |
| Bad Genius/ | 2024-11-21 17:06 | - | |
| Bag of Lies/ | 2024-10-25 04:36 | - | |
| Bajo el Silencio de las Aguas/ | 2024-10-29 16:58 | - | |
| Balestra/ | 2024-11-18 00:48 | - | |
| Ballistic/ | 2024-11-27 16:41 | - | |
| Bandida A Numero Um/ | 2024-09-20 04:35 | - | |
| Bangkok Breaking Fa Narok Mueang Thewada/ | 2024-09-26 19:49 | - | |
| Bark/ | 2024-12-11 15:08 | - | |
| Beauty And The Billionaire Bali/ | 2024-11-14 03:37 | - | |
| Becoming Santa/ | 2024-11-09 19:54 | - | |
| Beetlejuice Beetlejuice/ | 2024-10-08 15:02 | - | |
| Before Dawn/ | 2024-09-30 04:36 | - | |
| Believe In Christmas/ | 2024-12-03 00:44 | - | |
| Ben Affleck And Jennifer lopez Never Say Never/ | 2024-11-05 19:04 | - | |
| Betrayed By Love/ | 2024-10-17 15:25 | - | |
| Between The Temples/ | 2024-09-24 17:45 | - | |
| Biggest Heist Ever/ | 2024-12-06 22:25 | - | |
| Bird Of Paradise/ | 2024-12-03 00:45 | - | |
| Birdeater/ | 2024-11-30 21:34 | - | |
| Black Bags/ | 2024-11-18 00:48 | - | |
| Black Cab/ | 2024-11-09 19:56 | - | |
| Black Clover Sword Of The Wizard King/ | 2024-12-03 19:27 | - | |
| Black Tea/ | 2024-12-11 15:10 | - | |
| Blackwater Lane/ | 2024-11-09 19:57 | - | |
| Blitz/ | 2024-11-22 16:23 | - | |
| Blood for Dust/ | 2024-11-21 17:06 | - | |
| Bookworm/ | 2024-10-17 15:28 | - | |
| Borderlands/ | 2024-09-20 23:58 | - | |
| Bored Games/ | 2024-12-11 15:10 | - | |
| Boxer/ | 2024-09-20 05:01 | - | |
| Brandy Hellville The Cult Of Fast Fashion/ | 2024-11-08 05:50 | - | |
| Bread Roses/ | 2024-11-22 14:07 | - | |
| Breaking Exiting/ | 2024-11-07 05:39 | - | |
| Breakup Season/ | 2024-12-06 22:27 | - | |
| Brewsters Millions Christmas/ | 2024-12-08 04:22 | - | |
| Brigada A Los magníficos/ | 2024-09-20 20:20 | - | |
| Brothers/ | 2024-10-18 03:39 | - | |
| Buried Alive and Survived/ | 2024-09-24 03:41 | - | |
| Código Traje Rojo/ | 2024-11-15 04:57 | - | |
| CTRL/ | 2024-10-04 15:57 | - | |
| Ca Fetele/ | 2024-11-29 23:01 | - | |
| Caceria Sangrienta/ | 2024-10-31 13:42 | - | |
| Caddo Lake/ | 2024-10-10 16:30 | - | |
| Calor mortal/ | 2024-10-22 23:14 | - | |
| Cambio de bebés 2/ | 2024-11-21 19:23 | - | |
| Cambio de bebe 1/ | 2024-11-21 19:24 | - | |
| Camera/ | 2024-10-29 03:02 | - | |
| Campamento con mama/ | 2024-12-06 20:48 | - | |
| Campanas de Navidad/ | 2024-12-12 01:36 | - | |
| Canario negro/ | 2024-10-24 23:13 | - | |
| Caras vemos/ | 2024-10-31 16:49 | - | |
| Carved/ | 2024-10-21 21:31 | - | |
| Casa en flames/ | 2024-10-31 16:49 | - | |
| Casi el paraiso/ | 2024-11-16 06:22 | - | |
| Cellar Door/ | 2024-11-06 17:23 | - | |
| Chantal In Fairyland/ | 2024-11-22 03:09 | - | |
| Chasing Red/ | 2024-12-11 14:45 | - | |
| Chateau/ | 2024-12-09 02:21 | - | |
| Chief of Station/ | 2024-09-23 19:01 | - | |
| Child/ | 2024-11-21 17:06 | - | |
| Child Star/ | 2024-09-21 15:51 | - | |
| Christmas At Plumhill Manor/ | 2024-11-19 04:10 | - | |
| Christmas At The Greenbrier/ | 2024-12-05 19:48 | - | |
| Christmas At Xander Point/ | 2024-11-05 19:07 | - | |
| Christmas Eve In Millers Point/ | 2024-12-03 19:27 | - | |
| Christmas Love And Fudge/ | 2024-11-14 03:38 | - | |
| Christmas On Call/ | 2024-11-27 16:41 | - | |
| Christmas Under The Lights/ | 2024-11-30 21:34 | - | |
| Christmas With The Singhs/ | 2024-11-18 00:49 | - | |
| Christmas Wreaths And Ribbons/ | 2024-11-30 21:35 | - | |
| Christmas on Windmill Way/ | 2024-11-29 23:02 | - | |
| City Of Vultures/ | 2024-11-19 04:10 | - | |
| Classified/ | 2024-10-29 02:58 | - | |
| ClearMind/ | 2024-11-19 04:11 | - | |
| Conclave/ | 2024-11-27 01:50 | - | |
| Confessions Of A Christmas Letter/ | 2024-11-19 04:11 | - | |
| Conquer Lahad Datu/ | 2024-11-27 16:41 | - | |
| Conspiracy Theory/ | 2024-11-08 05:52 | - | |
| Contrato para matar/ | 2024-11-13 19:06 | - | |
| Corte en el tiempo/ | 2024-10-30 23:27 | - | |
| Crazy Racing/ | 2024-10-18 03:37 | - | |
| Creep/ | 2024-10-15 15:28 | - | |
| Crossing/ | 2024-09-20 04:42 | - | |
| Cuckoo/ | 2024-09-20 19:57 | - | |
| Culpa cero/ | 2024-10-04 15:35 | - | |
| Curse Of The Sin Eater/ | 2024-09-22 16:12 | - | |
| DSI Departamento Secreto de Intervencion/ | 2024-12-03 14:52 | - | |
| Daddio/ | 2024-10-29 16:58 | - | |
| Dance Rivals/ | 2024-12-06 22:27 | - | |
| Dead Poets Society/ | 2024-11-12 21:30 | - | |
| Deadly Fiancee/ | 2024-12-09 02:21 | - | |
| Deadpool Y Wolverine/ | 2024-10-01 00:04 | - | |
| Debbie Macombers Joyful Mrs Miracle/ | 2024-11-30 21:35 | - | |
| Deck The Walls/ | 2024-12-03 00:45 | - | |
| Defoe/ | 2024-11-30 21:35 | - | |
| Defying Gravity The Curtain Rises on Wicked/ | 2024-11-22 03:09 | - | |
| Del otro Lado del jardin/ | 2024-11-22 19:35 | - | |
| Del otro lado del jardin/ | 2024-10-25 17:24 | - | |
| Demise/ | 2024-10-17 15:26 | - | |
| De noche con el diablo/ | 2024-09-20 20:21 | - | |
| Denzel Washington American Icon/ | 2024-11-06 23:59 | - | |
| Depravity/ | 2024-10-21 21:32 | - | |
| Designing Christmas With You/ | 2024-12-08 05:15 | - | |
| Devon/ | 2024-11-14 03:38 | - | |
| Do Not Open/ | 2024-11-12 21:30 | - | |
| Do Patti/ | 2024-10-29 03:07 | - | |
| Do You Want To Die In Indio/ | 2024-11-07 05:39 | - | |
| Doble fortaleza/ | 2024-11-05 18:36 | - | |
| Doc Of Chucky/ | 2024-11-07 00:28 | - | |
| Dominique/ | 2024-10-29 16:58 | - | |
| Donner Pass/ | 2024-09-23 01:38 | - | |
| Doraemon The Movie Nobitas Earth Symphony/ | 2024-11-06 23:59 | - | |
| Drug stamps/ | 2024-12-06 22:29 | - | |
| Duelo de Espias/ | 2024-10-22 23:13 | - | |
| EFC/ | 2024-09-22 16:00 | - | |
| Ebenezer The Traveler/ | 2024-12-06 22:16 | - | |
| El CiempiEs Humano/ | 2024-10-15 15:28 | - | |
| El Demonio de Hielo/ | 2024-11-01 20:47 | - | |
| El Limite del placer/ | 2024-12-03 14:52 | - | |
| El Paraiso/ | 2024-12-03 00:45 | - | |
| El Pequeno Tom/ | 2024-10-15 04:52 | - | |
| El Rey del Crimen/ | 2024-09-20 20:21 | - | |
| El buho y la nina Casi una historia navidena/ | 2024-11-27 01:50 | - | |
| El cuervo/ | 2024-09-20 05:12 | - | |
| El destino de Sikandar/ | 2024-11-29 20:57 | - | |
| El diario/ | 2024-10-04 15:58 | - | |
| El hoyo/ | 2024-10-04 16:33 | - | |
| El lugar de la otra/ | 2024-10-11 16:32 | - | |
| El plan del asesino/ | 2024-11-08 18:55 | - | |
| El secuestro de 1993/ | 2024-11-05 18:36 | - | |
| El tren de los ninos/ | 2024-12-04 17:36 | - | |
| El ultimo Guerrillero/ | 2024-12-04 17:41 | - | |
| Emilia Perez/ | 2024-11-14 03:38 | - | |
| Enchanting Christmas/ | 2024-12-08 05:15 | - | |
| End Times/ | 2024-11-19 04:11 | - | |
| Endurance/ | 2024-11-07 00:08 | - | |
| Entra en mi vida/ | 2024-11-05 04:41 | - | |
| Entrapment/ | 2024-11-08 05:51 | - | |
| Erdal Ile Ece 2/ | 2024-12-11 14:45 | - | |
| Esme My Love/ | 2024-09-25 23:49 | - | |
| Everest/ | 2024-11-06 20:43 | - | |
| Ex Husbands/ | 2024-11-07 05:39 | - | |
| Exhibiting Forgiveness/ | 2024-12-03 19:27 | - | |
| Exorcismo/ | 2024-09-20 20:21 | - | |
| Expedition Amazon/ | 2024-11-06 23:59 | - | |
| Falling Together/ | 2024-09-24 03:41 | - | |
| Family Guy Gift of the White Guy/ | 2024-11-26 14:46 | - | |
| Family Guy Halloween Special/ | 2024-10-25 21:33 | - | |
| Fanmade Enhypen/ | 2024-12-04 23:34 | - | |
| Fce Off/ | 2024-09-23 19:01 | - | |
| Feather Christmas/ | 2024-11-23 02:58 | - | |
| First Contact/ | 2024-12-08 04:22 | - | |
| Five Gold Rings/ | 2024-11-09 19:56 | - | |
| For Walter And Josiah/ | 2024-11-25 19:55 | - | |
| Forgive Me Father/ | 2024-12-03 00:46 | - | |
| Fortune Feimster Crushing It/ | 2024-12-04 23:34 | - | |
| Fracture/ | 2024-09-26 03:04 | - | |
| Frankie Freako/ | 2024-11-12 21:30 | - | |
| Freediver/ | 2024-12-08 04:22 | - | |
| GTMax/ | 2024-11-21 17:06 | - | |
| Get Fast/ | 2024-11-18 00:49 | - | |
| Ghosts of Red Ridge/ | 2024-12-03 19:27 | - | |
| Gladiator/ | 2024-11-12 18:28 | - | |
| Go West/ | 2024-09-22 16:12 | - | |
| Gods Not Dead In God We Trust/ | 2024-10-04 17:36 | - | |
| Goebbels And The Fuhrer/ | 2024-10-04 17:36 | - | |
| Gone With The Boat/ | 2024-11-20 00:36 | - | |
| Good Boy/ | 2024-10-25 22:20 | - | |
| Good One/ | 2024-10-17 15:26 | - | |
| Good Will Hunting/ | 2024-11-12 21:30 | - | |
| Goodrich/ | 2024-11-12 22:01 | - | |
| Government Gangsters/ | 2024-12-03 14:52 | - | |
| Gracie.and Pedro Mission Impossible/ | 2024-11-29 23:02 | - | |
| Gracie and Pedro Pets to the Rescue/ | 2024-09-30 22:48 | - | |
| Graveyard Shark/ | 2024-12-04 23:34 | - | |
| Grey s Anatomy/ | 2024-12-08 04:22 | - | |
| Guerra a La Trata/ | 2024-09-20 20:22 | - | |
| HITPIG/ | 2024-11-29 23:02 | - | |
| Haikyu La Batalla del Basurero/ | 2024-11-02 17:06 | - | |
| Harry And Meghan Going Their Separate Ways/ | 2024-11-05 18:38 | - | |
| Hasan Minhaj Off With His Head/ | 2024-10-29 03:01 | - | |
| Hasta la madre de la Navidad/ | 2024-11-29 20:58 | - | |
| Hatching Eagles/ | 2024-12-08 04:22 | - | |
| Haunted Wedding/ | 2024-10-17 15:25 | - | |
| Haunted by Her Name/ | 2024-10-17 15:27 | - | |
| Hazard/ | 2024-12-11 14:45 | - | |
| Head Over Heels/ | 2024-09-22 16:00 | - | |
| Heartbreak Motel/ | 2024-12-05 19:49 | - | |
| Hellboy The Crooked Man/ | 2024-10-24 23:40 | - | |
| Here/ | 2024-11-27 16:41 | - | |
| His And Hers/ | 2024-09-22 16:00 | - | |
| Hold Your Breath/ | 2024-10-03 19:54 | - | |
| Holiday Crashers/ | 2024-10-21 21:31 | - | |
| Holiday Mismatch/ | 2024-11-05 18:38 | - | |
| Holiday Touchdown A Chiefs Love Story/ | 2024-12-03 00:46 | - | |
| Hollywood Ending/ | 2024-11-25 19:55 | - | |
| Horizon An American Saga/ | 2024-10-22 23:13 | - | |
| Horrorland/ | 2024-10-29 16:59 | - | |
| House of Spoils/ | 2024-10-03 19:45 | - | |
| How To Make Millions Before Grandma Dies/ | 2024-11-23 02:58 | - | |
| How To Win A Prince/ | 2024-11-19 04:11 | - | |
| Huntress/ | 2024-12-06 22:16 | - | |
| Hush/ | 2024-11-25 19:56 | - | |
| I The Executioner/ | 2024-11-23 02:58 | - | |
| I Used To Be Funny/ | 2024-11-25 19:56 | - | |
| Idiocracy/ | 2024-09-29 23:51 | - | |
| Ill Be Right There/ | 2024-11-14 03:39 | - | |
| Inseparables/ | 2024-10-09 00:14 | - | |
| In the Summers/ | 2024-11-05 18:50 | - | |
| Islas Way/ | 2024-12-08 04:22 | - | |
| It Ends with Us/ | 2024-09-23 16:03 | - | |
| Its A Boy Girl Thing/ | 2024-09-23 01:26 | - | |
| Its Whats Inside/ | 2024-10-04 15:57 | - | |
| JFK X Solving The Crime Of The Century/ | 2024-11-14 03:39 | - | |
| Jack In time For Christmas/ | 2024-12-03 14:52 | - | |
| Jack en la caja maldita 3 El ascenso/ | 2024-10-24 04:05 | - | |
| Jake Paul Vs Mike Tyson/ | 2024-11-18 00:51 | - | |
| James Acaster Hecklers Welcome/ | 2024-11-25 19:56 | - | |
| Jamie Foxx What Had Happened Was/ | 2024-12-11 14:45 | - | |
| Janet Planet/ | 2024-11-30 02:13 | - | |
| Jeff Dunhams Scrooged Up Holiday Special/ | 2024-11-20 00:37 | - | |
| Jeon Ran/ | 2024-10-11 16:32 | - | |
| Jigra/ | 2024-12-08 04:22 | - | |
| Jim Gaffigan The Skinny/ | 2024-11-23 03:43 | - | |
| Jingle Bell Love/ | 2024-11-19 04:12 | - | |
| Jingle Bell Run/ | 2024-11-19 04:12 | - | |
| Joker Folie a Deux/ | 2024-10-29 16:27 | - | |
| Joy/ | 2024-11-22 19:35 | - | |
| Jurado 2/ | 2024-12-03 14:52 | - | |
| Kabahat/ | 2024-11-23 02:58 | - | |
| Kanguva/ | 2024-12-09 02:21 | - | |
| Kensukes Kingdom/ | 2024-11-19 04:19 | - | |
| Kill Em All 2/ | 2024-09-24 19:39 | - | |
| Killer Ex/ | 2024-11-14 03:39 | - | |
| Killing All My Sisters/ | 2024-12-06 01:36 | - | |
| Kneecap/ | 2024-11-06 17:19 | - | |
| Komandir/ | 2024-11-12 21:30 | - | |
| Krazy House/ | 2024-11-30 21:36 | - | |
| Kreepaway Kamp/ | 2024-10-16 18:38 | - | |
| LEGO Marvel Avengers Mission Demolition/ | 2024-10-20 05:01 | - | |
| La Avispa/ | 2024-12-04 17:43 | - | |
| La Noche De Los Desaparecidos/ | 2024-09-20 20:22 | - | |
| La Pastelera/ | 2024-09-25 23:49 | - | |
| LaRoy Texas/ | 2024-11-22 03:09 | - | |
| La Sustituta/ | 2024-09-20 20:23 | - | |
| La cueva azul/ | 2024-10-20 05:01 | - | |
| La hermana de nieve/ | 2024-11-29 20:59 | - | |
| Lake George/ | 2024-12-06 22:16 | - | |
| La reina de fuego/ | 2024-11-29 21:05 | - | |
| Larger Than Life Reign Of The Boybands/ | 2024-11-12 21:58 | - | |
| Las Huellas De ElBulli/ | 2024-11-25 19:57 | - | |
| Las Tias/ | 2024-11-21 19:25 | - | |
| Last ExMas/ | 2024-12-03 00:46 | - | |
| Last Known Location/ | 2024-12-05 19:49 | - | |
| Last Straw/ | 2024-09-22 16:11 | - | |
| Las tres hijas/ | 2024-09-21 01:33 | - | |
| La sustancia/ | 2024-11-01 20:47 | - | |
| La virgen roja/ | 2024-12-05 18:14 | - | |
| Le Plongeur/ | 2024-12-05 19:49 | - | |
| Leahs Perfect Gift/ | 2024-12-10 02:32 | - | |
| Le consentement/ | 2024-09-20 04:59 | - | |
| Legalmente rubia/ | 2024-11-17 07:38 | - | |
| Leio/ | 2024-09-24 17:44 | - | |
| Lets Start A Cult/ | 2024-11-12 21:53 | - | |
| Letters At Christmas/ | 2024-11-27 16:41 | - | |
| Libre/ | 2024-11-02 17:06 | - | |
| Light Em Up Ghostbusters Past Present And Future/ | 2024-11-05 18:38 | - | |
| Linda/ | 2024-11-21 19:25 | - | |
| Link/ | 2024-09-25 00:17 | - | |
| Lobos/ | 2024-09-27 18:30 | - | |
| Loco por Mary/ | 2024-10-04 17:31 | - | |
| Londres al filo del tiempo/ | 2024-12-03 14:52 | - | |
| Lonely Planet/ | 2024-10-11 16:32 | - | |
| Lonesome Soldier/ | 2024-12-11 14:45 | - | |
| Longlegs Coleccionista de alma/ | 2024-10-18 05:48 | - | |
| Look Back Continua dibujando/ | 2024-11-09 03:29 | - | |
| Look Into My Eyes/ | 2024-11-13 02:13 | - | |
| Los amantes pasajeros/ | 2024-09-25 00:16 | - | |
| Los festivos caballeros/ | 2024-11-21 19:22 | - | |
| Los iniciados El diario de las sombras/ | 2024-09-30 03:47 | - | |
| Los vecinos Green/ | 2024-10-22 23:13 | - | |
| Louder The Soundtrack of Change/ | 2024-10-29 03:07 | - | |
| Loups-Garous/ | 2024-10-31 16:49 | - | |
| Love According To Dalva/ | 2024-12-08 04:22 | - | |
| Love Bomb/ | 2024-12-11 14:45 | - | |
| Love Mocktail 2/ | 2024-12-03 19:27 | - | |
| Made In England The Films Of Powell And Pressburger/ | 2024-11-12 21:52 | - | |
| Magic Mike/ | 2024-09-23 01:40 | - | |
| Magpie/ | 2024-11-12 21:30 | - | |
| Make A Wish/ | 2024-12-03 00:53 | - | |
| Man and Witch the Dance of a Thousand Steps/ | 2024-11-05 18:38 | - | |
| Manos milagrosas/ | 2024-09-20 20:23 | - | |
| Maria/ | 2024-12-12 01:36 | - | |
| Marmalade/ | 2024-11-09 20:23 | - | |
| Martha/ | 2024-11-05 18:55 | - | |
| Matka/ | 2024-12-08 04:22 | - | |
| Maverick/ | 2024-11-08 05:50 | - | |
| Mayday club/ | 2024-09-20 20:23 | - | |
| Meanwhile On Earth/ | 2024-11-20 00:37 | - | |
| Meet Me At The Christmas Train Parade/ | 2024-12-03 19:27 | - | |
| Megalopolis/ | 2024-11-12 21:30 | - | |
| Megan Thee Stallion In Her Words/ | 2024-11-03 02:55 | - | |
| Memoir Of A Snail/ | 2024-11-23 20:46 | - | |
| Merry Birthday Happy Christmas/ | 2024-12-06 01:41 | - | |
| Mi amigo el pingUino/ | 2024-10-29 16:59 | - | |
| Mickey and the Very Many Christmases/ | 2024-12-03 19:27 | - | |
| Midas Man/ | 2024-11-05 18:55 | - | |
| Miki/ | 2024-11-23 02:58 | - | |
| Mind Wave/ | 2024-12-06 22:16 | - | |
| Miss PJ/ | 2024-11-19 04:21 | - | |
| Missing/ | 2024-09-21 15:50 | - | |
| Money Electric The Bitcoin Mystery/ | 2024-10-15 15:28 | - | |
| Monolith/ | 2024-11-25 19:57 | - | |
| Mononoke The Movie The Phantom in The Rain/ | 2024-11-30 02:14 | - | |
| Mothers Instinct/ | 2024-09-30 22:48 | - | |
| Move Like A Boss/ | 2024-10-29 03:07 | - | |
| Music Box Yacht Rock A DOCKumentary/ | 2024-11-30 23:44 | - | |
| Music by John Williams/ | 2024-11-05 18:38 | - | |
| My Favourite Cake/ | 2024-11-29 23:03 | - | |
| My Little Pony A New Generation/ | 2024-10-27 05:36 | - | |
| My Nanny Stole My Life/ | 2024-12-03 00:54 | - | |
| My Old Ass/ | 2024-11-08 18:57 | - | |
| My Sons Deception/ | 2024-11-27 16:42 | - | |
| My Sweet Austrian Holiday/ | 2024-11-06 23:59 | - | |
| Napad/ | 2024-10-18 03:36 | - | |
| No Entres/ | 2024-11-07 00:26 | - | |
| No me abandones/ | 2024-12-04 17:54 | - | |
| Norbert4/ | 2024-12-03 14:52 | - | |
| Nos vemos la prOxima Navidad/ | 2024-11-06 17:20 | - | |
| No te muevas/ | 2024-10-25 17:25 | - | |
| No te sueltes/ | 2024-11-18 04:40 | - | |
| Nugget is Dead A Christmas Story/ | 2024-11-22 03:09 | - | |
| Nutcrackers/ | 2024-11-29 23:04 | - | |
| Oasis/ | 2024-09-21 15:51 | - | |
| Objetivo secreto/ | 2024-11-06 17:22 | - | |
| Oceans Thirteen/ | 2024-10-30 23:14 | - | |
| Officer Black Belt/ | 2024-09-20 04:44 | - | |
| Omni Loop/ | 2024-09-22 16:10 | - | |
| On Chesil Beach/ | 2024-09-24 17:45 | - | |
| Once Upon A Christmas Wish/ | 2024-11-30 21:36 | - | |
| One Last Time An Evening With Tony Bennett And Lady Gaga/ | 2024-12-10 02:32 | - | |
| Operation Hope The Children Lost In The Amazon/ | 2024-11-06 23:59 | - | |
| Operation Mistletoe/ | 2024-12-03 19:27 | - | |
| Operation Nutcracker/ | 2024-11-08 18:59 | - | |
| Operation Undead/ | 2024-12-11 14:45 | - | |
| Orango/ | 2024-11-30 21:56 | - | |
| Our Holiday Story/ | 2024-11-07 00:26 | - | |
| Our Little Secret/ | 2024-11-27 17:27 | - | |
| Out Of Egypt/ | 2024-12-09 02:21 | - | |
| Out Of Season/ | 2024-11-23 03:43 | - | |
| Out of My Mind/ | 2024-11-22 19:34 | - | |
| Outside/ | 2024-10-18 03:37 | - | |
| Overlord El reino sagrado/ | 2024-11-15 04:57 | - | |
| Ozi Voice Of The Forest/ | 2024-11-19 04:22 | - | |
| Pacific Heights/ | 2024-09-23 18:26 | - | |
| Pandemonium La Capital del Infierno/ | 2024-12-03 15:13 | - | |
| Paralle/ | 2024-11-22 03:09 | - | |
| Parano iA/ | 2024-09-28 15:33 | - | |
| Parents For Christmas/ | 2024-11-30 21:56 | - | |
| Parpadea dos veces/ | 2024-09-20 20:24 | - | |
| Paul Reiser Life Death And Rice Pudding/ | 2024-12-06 22:16 | - | |
| Peak Season/ | 2024-09-22 16:10 | - | |
| Pedro PAramo/ | 2024-11-06 17:24 | - | |
| Peques/ | 2024-10-22 23:14 | - | |
| Perros de guerra/ | 2024-09-20 20:26 | - | |
| Pharrell Williams Pieza por pieza/ | 2024-10-29 17:07 | - | |
| Phullwanti/ | 2024-12-05 19:49 | - | |
| Pimpinero Sangre y gasolina/ | 2024-11-22 16:23 | - | |
| Pitbull/ | 2024-11-25 19:57 | - | |
| Poison Ivy/ | 2024-12-03 19:27 | - | |
| Poison Ivy 2/ | 2024-12-03 19:30 | - | |
| Porch Pirates/ | 2024-11-30 21:56 | - | |
| Princesa Adormecida/ | 2024-12-04 23:34 | - | |
| Princess Halle And The Jester/ | 2024-12-06 22:16 | - | |
| Private Princess Christmas/ | 2024-12-08 04:22 | - | |
| Psycho Pass Providence/ | 2024-11-09 19:54 | - | |
| Querido Santa/ | 2024-11-26 02:36 | - | |
| Rain for Christmas/ | 2024-11-05 18:57 | - | |
| Reagan/ | 2024-10-17 15:25 | - | |
| Red One/ | 2024-11-09 18:28 | - | |
| Retiro Mortal 2/ | 2024-09-30 03:47 | - | |
| Return Of The King The Fall And Rise Of Elvis Presley/ | 2024-11-18 00:52 | - | |
| Revolver/ | 2024-09-22 15:59 | - | |
| Rez Ball/ | 2024-09-27 18:29 | - | |
| Rippy/ | 2024-10-21 21:31 | - | |
| Rita/ | 2024-11-23 02:58 | - | |
| River Of Ghosts/ | 2024-11-29 23:05 | - | |
| Robot salvaje/ | 2024-10-15 07:48 | - | |
| Rozwodnicy/ | 2024-09-25 15:10 | - | |
| Rumours/ | 2024-11-12 21:52 | - | |
| Run/ | 2024-12-06 01:43 | - | |
| Ruslaan/ | 2024-11-18 00:52 | - | |
| SEVENTEEN TOUR FOLLOW AGAIN/ | 2024-10-21 21:59 | - | |
| STELLA A LIFE/ | 2024-11-29 23:13 | - | |
| Salem Witch Doll/ | 2024-12-06 22:16 | - | |
| Salems Lot/ | 2024-10-03 19:51 | - | |
| Salvajes/ | 2024-10-08 15:42 | - | |
| Santa Baby/ | 2024-11-09 19:54 | - | |
| Santa Hunters/ | 2024-11-03 02:53 | - | |
| Santa Tell Me/ | 2024-11-14 03:44 | - | |
| Santastein/ | 2024-11-27 16:42 | - | |
| Schlitter/ | 2024-12-08 04:22 | - | |
| School Tie/ | 2024-12-09 02:21 | - | |
| Scouting For Christmas/ | 2024-11-06 23:59 | - | |
| Seasons Greetings From Cherry Lane/ | 2024-12-08 04:25 | - | |
| Secret Zoo/ | 2024-11-12 21:30 | - | |
| Secrets Between Sisters/ | 2024-11-06 23:59 | - | |
| Sector 36/ | 2024-09-20 20:27 | - | |
| Serena Williams The Power And The Glory/ | 2024-11-25 19:57 | - | |
| Seth Meyers Dad Man Walking/ | 2024-10-29 03:05 | - | |
| Seven Cemeteries/ | 2024-10-21 21:30 | - | |
| Sevn Samrai/ | 2024-09-30 02:15 | - | |
| Shadows Side/ | 2024-12-09 02:21 | - | |
| Shes Too Young/ | 2024-12-09 02:21 | - | |
| ShiP Life/ | 2024-12-11 14:45 | - | |
| Shin Kamen Rider/ | 2024-12-08 04:32 | - | |
| Shivam Bhaje/ | 2024-12-03 19:36 | - | |
| Siempre Estare Contigo/ | 2024-11-21 19:22 | - | |
| Silent Bite/ | 2024-11-19 04:22 | - | |
| Sin City 2/ | 2024-10-15 05:24 | - | |
| Sin City La ciudad del pecado/ | 2024-10-15 04:52 | - | |
| Sin Piedad/ | 2024-10-15 04:52 | - | |
| Sing Sing/ | 2024-09-21 15:51 | - | |
| Sing Ven y canta Thriller/ | 2024-10-25 04:20 | - | |
| Sin refugio/ | 2024-10-29 17:18 | - | |
| Skincare/ | 2024-11-16 06:25 | - | |
| Slingshot/ | 2024-09-20 19:57 | - | |
| Snow Whites Christmas Adventure/ | 2024-12-11 14:45 | - | |
| Snowy With A Chance Of Christmas/ | 2024-11-18 01:09 | - | |
| Sonrie 2/ | 2024-11-20 01:06 | - | |
| South Park The End Of Obesity/ | 2024-12-04 23:34 | - | |
| Speak No Evil/ | 2024-10-07 03:43 | - | |
| Spellbound/ | 2024-11-22 19:34 | - | |
| Spin the Bottle/ | 2024-10-04 17:36 | - | |
| Spirit Of Friendship/ | 2024-12-06 22:16 | - | |
| Spirit in the Blood/ | 2024-10-29 03:00 | - | |
| Steal The Naughty List/ | 2024-11-18 01:09 | - | |
| Stepne/ | 2024-11-27 16:42 | - | |
| Stream/ | 2024-10-21 21:32 | - | |
| Street Trash/ | 2024-11-20 00:37 | - | |
| Strul/ | 2024-10-03 19:46 | - | |
| Style Me For Christmas/ | 2024-11-20 00:37 | - | |
| Subservience/ | 2024-12-03 15:15 | - | |
| Sugarplummed/ | 2024-12-09 02:21 | - | |
| Summer Rain/ | 2024-11-23 02:58 | - | |
| Super Man The Christopher Reeve Story/ | 2024-11-05 18:38 | - | |
| Surveilled/ | 2024-11-22 03:09 | - | |
| Survive/ | 2024-11-07 00:31 | - | |
| Swap/ | 2024-11-20 00:38 | - | |
| Sweethearts/ | 2024-12-03 15:16 | - | |
| Swing Into Romance/ | 2024-11-30 21:57 | - | |
| Tails Of Christmas/ | 2024-11-07 00:32 | - | |
| Tam Bir Centilmen/ | 2024-09-26 19:49 | - | |
| Team Bride/ | 2024-11-19 04:22 | - | |
| Technoboys/ | 2024-09-20 20:31 | - | |
| Terrifier 3/ | 2024-10-24 23:51 | - | |
| Tesciowie/ | 2024-09-25 03:43 | - | |
| ThE Keepers Of The 5 Kingdoms/ | 2024-11-25 19:58 | - | |
| Thangalaan/ | 2024-12-11 14:45 | - | |
| The 5-Year christmas Party/ | 2024-11-06 23:59 | - | |
| The Actor/ | 2024-10-29 15:50 | - | |
| The Apprentice/ | 2024-11-03 02:54 | - | |
| The Arctic Convoy/ | 2024-11-05 18:55 | - | |
| The Bad Guy/ | 2024-12-06 22:16 | - | |
| The Bad Guys Haunted Heist/ | 2024-10-03 19:46 | - | |
| The Best Christmas Pageant Ever/ | 2024-12-11 16:03 | - | |
| The Bridge/ | 2024-11-29 23:16 | - | |
| The Christmas Brew/ | 2024-09-22 16:00 | - | |
| The Christmas Charade/ | 2024-10-29 02:59 | - | |
| The Christmas Quest/ | 2024-12-03 19:39 | - | |
| The Christmas Room/ | 2024-12-06 22:16 | - | |
| The Circuit 4 Faith Fighter/ | 2024-12-06 01:44 | - | |
| The Contract/ | 2024-11-12 21:30 | - | |
| The Count Of Monte Cristo/ | 2024-11-19 04:25 | - | |
| The Critic/ | 2024-10-29 02:59 | - | |
| The Curious Case of Benjamin Button/ | 2024-10-27 05:57 | - | |
| The Curse Of The Necklace/ | 2024-11-11 19:41 | - | |
| The Damned/ | 2024-09-24 03:41 | - | |
| The Devils Climb/ | 2024-10-21 21:32 | - | |
| The Dish The Spoon/ | 2024-11-27 16:42 | - | |
| The Duel/ | 2024-09-21 01:32 | - | |
| The Duelist/ | 2024-10-08 02:22 | - | |
| The Experts/ | 2024-12-08 04:33 | - | |
| The Finnish Line/ | 2024-12-03 00:56 | - | |
| The Firing Squad/ | 2024-11-19 04:25 | - | |
| The Fix/ | 2024-11-22 14:08 | - | |
| The Fly/ | 2024-10-15 15:29 | - | |
| The Forge/ | 2024-10-08 16:11 | - | |
| The French Montana Story For Khadija/ | 2024-11-20 00:38 | - | |
| The Front Room/ | 2024-09-24 17:45 | - | |
| The Girls Aloud Show Live At The O2/ | 2024-11-19 04:25 | - | |
| The Girl with No Name/ | 2024-11-29 23:18 | - | |
| The Groomsmen First Look/ | 2024-12-05 19:50 | - | |
| The Groomsmen Last Dance/ | 2024-12-05 19:59 | - | |
| The Gutter/ | 2024-12-03 19:39 | - | |
| The Honorable Shyne/ | 2024-11-19 04:26 | - | |
| The Invisible Raptor/ | 2024-12-11 14:52 | - | |
| The Keepers Of The 5 Kingdoms/ | 2024-11-20 00:43 | - | |
| The Last Redemption/ | 2024-11-20 00:45 | - | |
| The Life And Deaths Of Christopher Lee/ | 2024-11-27 16:44 | - | |
| The Lonely Man With The Ghost Machine/ | 2024-09-24 03:41 | - | |
| The Lost Children/ | 2024-11-18 01:12 | - | |
| The Mean One/ | 2024-11-22 03:09 | - | |
| The Menendez Brothers/ | 2024-10-08 16:11 | - | |
| The Merry Gentlemen/ | 2024-11-21 17:06 | - | |
| The Mule/ | 2024-10-11 03:58 | - | |
| The Mystery Of Mr E/ | 2024-12-11 14:55 | - | |
| The Night Before Christmas In Wonderland/ | 2024-11-18 01:13 | - | |
| The Only Girl in the Orchestra/ | 2024-12-04 23:34 | - | |
| The Other Side Of Midnight/ | 2024-12-11 14:56 | - | |
| The Outrun/ | 2024-11-05 18:42 | - | |
| The Pelican Brief/ | 2024-11-08 05:51 | - | |
| The Piano Lesson/ | 2024-11-22 19:34 | - | |
| The Price Of Money A Largo Winch Adventure/ | 2024-11-29 23:26 | - | |
| The Primrose Railway Children/ | 2024-12-03 00:57 | - | |
| The Radleys/ | 2024-10-04 17:36 | - | |
| The Rapture/ | 2024-11-18 01:14 | - | |
| The Real Full Monty/ | 2024-12-11 14:58 | - | |
| The Remarkable Life of Ibelin/ | 2024-10-26 16:58 | - | |
| The Royal Four Stronger Together/ | 2024-12-06 01:44 | - | |
| The Secret of Roan Inish/ | 2024-09-28 15:32 | - | |
| The Shade/ | 2024-11-23 02:58 | - | |
| The Shadow Strays/ | 2024-10-18 03:37 | - | |
| The Sky Above Zenica/ | 2024-11-22 14:08 | - | |
| The Stoic/ | 2024-10-21 21:32 | - | |
| The Story Of Playstation/ | 2024-11-23 02:58 | - | |
| The Summer We Died/ | 2024-12-11 14:59 | - | |
| The Syndrome/ | 2024-09-20 04:37 | - | |
| The Thicket/ | 2024-09-22 16:01 | - | |
| The Thomas Crown Affair/ | 2024-11-08 05:52 | - | |
| The Trouble with Jessica/ | 2024-10-08 16:41 | - | |
| The Turnaround/ | 2024-10-31 16:49 | - | |
| The Warrior Class/ | 2024-11-22 14:08 | - | |
| The Well/ | 2024-12-08 05:15 | - | |
| The Wonderful World Of Disney Holiday Spectacular/ | 2024-12-03 00:58 | - | |
| Thelma/ | 2024-10-29 17:21 | - | |
| Thick as Thieves/ | 2024-09-29 23:51 | - | |
| Things Will Be Different/ | 2024-10-04 17:36 | - | |
| This Time Each Year/ | 2024-10-29 03:00 | - | |
| This Time Next Year/ | 2024-09-22 15:59 | - | |
| Thomas Friends the Christmas Letter Express 2024.1080p.INGLES/ | 2024-11-22 03:09 | - | |
| Three Wiser Men And A Boy/ | 2024-11-27 16:51 | - | |
| Tigres Et Hyenes/ | 2024-11-22 14:07 | - | |
| Time Still Turns The Pages/ | 2024-11-07 01:28 | - | |
| Tint n en el templo del sol/ | 2024-11-16 06:24 | - | |
| Tis The Season To Be Irish/ | 2024-11-13 01:27 | - | |
| Titanic The Musical/ | 2024-11-18 01:18 | - | |
| To Have And To Holiday/ | 2024-11-29 23:29 | - | |
| Tokyo Ghoul/ | 2024-12-03 00:58 | - | |
| Tom Cruise the Last Movie Star/ | 2024-12-03 15:17 | - | |
| Transformers One/ | 2024-10-25 04:36 | - | |
| Transformers Uno/ | 2024-10-22 20:56 | - | |
| Transmitzvah/ | 2024-11-23 22:14 | - | |
| Trap/ | 2024-11-23 19:40 | - | |
| Tras las Huellas del Peligro/ | 2024-09-20 20:32 | - | |
| Treasure Trackers/ | 2024-11-07 00:22 | - | |
| Trivia At St Nicks/ | 2024-11-09 19:55 | - | |
| Troll Storm/ | 2024-12-06 22:24 | - | |
| Tuesday el ultimo abrazo/ | 2024-09-20 20:33 | - | |
| Twas The Date Before Christmas/ | 2024-11-07 00:05 | - | |
| Twas the Text Before Christmas/ | 2024-11-29 23:31 | - | |
| Twinkle All The Way/ | 2024-12-08 05:15 | - | |
| Two Chefs And A Wedding Cake/ | 2024-11-18 01:18 | - | |
| UFC Fight Night 248 Yan vs Figueiredo/ | 2024-11-25 20:00 | - | |
| Uglies/ | 2024-09-20 04:41 | - | |
| Umjolo Perdidamente enamorada/ | 2024-11-08 20:32 | - | |
| Un Culto a La Oscuridad/ | 2024-11-08 18:50 | - | |
| Un Happy For You/ | 2024-11-20 00:46 | - | |
| Una Segunda Oportunidad/ | 2024-09-20 20:34 | - | |
| Una jirafa en el balcOn/ | 2024-11-06 16:59 | - | |
| Undisputed/ | 2024-12-11 15:00 | - | |
| Un muneco de nieve para derretirse/ | 2024-11-13 19:14 | - | |
| Until I Kill You The Real Story/ | 2024-11-05 18:38 | - | |
| Un viaje al corazon The Wingwalker/ | 2024-12-12 02:09 | - | |
| Unwrapping Christmas Mias Prince/ | 2024-11-18 01:20 | - | |
| Unwrapping Christmas Olivias Reunion/ | 2024-11-29 23:32 | - | |
| Unwrapping Christmas Tinas Miracle/ | 2024-11-14 03:46 | - | |
| Uprising/ | 2024-11-07 01:28 | - | |
| VHSBeyond/ | 2024-10-04 17:36 | - | |
| Valentines Town/ | 2024-10-29 15:50 | - | |
| V de Victor/ | 2024-09-20 20:35 | - | |
| Vida Eterna/ | 2024-10-24 04:05 | - | |
| Vijay 69/ | 2024-11-08 21:41 | - | |
| Violett/ | 2024-09-22 16:00 | - | |
| Viswam/ | 2024-11-07 00:23 | - | |
| WWE Crown Jewel/ | 2024-11-08 18:49 | - | |
| WWE Survivor Series WarGames/ | 2024-12-03 15:23 | - | |
| War Blade/ | 2024-11-03 02:55 | - | |
| War Game/ | 2024-11-18 01:21 | - | |
| Watchmen Chapter 2/ | 2024-11-27 16:52 | - | |
| We Live in Time/ | 2024-11-22 14:09 | - | |
| Weekend In Taipei/ | 2024-12-03 19:40 | - | |
| What Jennifer/ | 2024-09-29 23:51 | - | |
| What Women Want/ | 2024-11-08 05:53 | - | |
| When Love Strikes/ | 2024-12-05 20:00 | - | |
| Whispers In The Wind/ | 2024-11-22 14:09 | - | |
| Whiteout/ | 2024-11-23 02:58 | - | |
| Who Kidnapped My Mom/ | 2024-12-11 15:00 | - | |
| Why Did I Get Married/ | 2024-11-22 21:13 | - | |
| Why Did I Get Married Too/ | 2024-11-22 21:06 | - | |
| Wilfred Buck/ | 2024-12-05 20:01 | - | |
| Willie and Me/ | 2024-09-22 16:01 | - | |
| Witches/ | 2024-11-27 16:53 | - | |
| Woman of the Hour/ | 2024-10-20 05:00 | - | |
| Wrong Numbers/ | 2024-12-10 02:32 | - | |
| Wynonna Earp Vengeance/ | 2024-11-25 20:03 | - | |
| Year/ | 2024-12-06 01:44 | - | |
| You Gotta Believe/ | 2024-09-20 23:58 | - | |
| Youre Killing Me/ | 2024-11-18 01:29 | - | |
| Zane Lamprey Ski Patrol/ | 2024-11-30 21:58 | - | |
| Zipperface/ | 2024-12-11 15:03 | - | |
| Zondebokken/ | 2024-11-22 03:09 | - | |
| a sudden case of christmas/ | 2024-11-09 19:53 | - | |
| codigo traje rojo/ | 2024-12-12 16:16 | - | |
| coll as ice/ | 2024-10-11 15:16 | - | |
| l buho y la nina Casi una historia navidena/ | 2024-11-16 06:24 | - | |
| venom ultimo baile/ | 2024-12-09 20:31 | - | |